C19H14O2 — CID 164546604
14-tetracyclo[6.6.1.02,6.012,15]pentadeca-1,3,5,8(15),9,11,13-heptaenyl 2-methylprop-2-enoate (PubChem CID 164546604) has the molecular formula C19H14O2 and a molecular weight of 274.32 g/mol. Its IUPAC name is 14-tetracyclo[6.6.1.02,6.012,15]pentadeca-1,3,5,8(15),9,11,13-heptaenyl 2-methylprop-2-enoate.
| Compound Name | 14-tetracyclo[6.6.1.02,6.012,15]pentadeca-1,3,5,8(15),9,11,13-heptaenyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 164546604 |
| Molecular Formula | C19H14O2 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | 14-tetracyclo[6.6.1.02,6.012,15]pentadeca-1,3,5,8(15),9,11,13-heptaenyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC1=Cc2cccc3c2C1=C1C=CC=C1C3 |
| InChI | InChI=1S/C19H14O2/c1-11(2)19(20)21-16-10-14-7-3-6-13-9-12-5-4-8-15(12)18(16)17(13)14/h3-8,10H,1,9H2,2H3 |
| InChIKey | CIUUNMKLNZBDGV-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|