C20H18O2 — CID 175558627
2-bicyclo[7.7.0]hexadeca-1(16),2,4,6,8,10,12,14-octaenyl 2-methylprop-2-enoate (PubChem CID 175558627) has the molecular formula C20H18O2 and a molecular weight of 290.36 g/mol. Its IUPAC name is 2-bicyclo[7.7.0]hexadeca-1(16),2,4,6,8,10,12,14-octaenyl 2-methylprop-2-enoate.
| Compound Name | 2-bicyclo[7.7.0]hexadeca-1(16),2,4,6,8,10,12,14-octaenyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 175558627 |
| Molecular Formula | C20H18O2 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | 2-bicyclo[7.7.0]hexadeca-1(16),2,4,6,8,10,12,14-octaenyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC1=CC=CC=CC=C2C=CC=CC=CC=C21 |
| InChI | InChI=1S/C20H18O2/c1-16(2)20(21)22-19-15-11-7-6-9-13-17-12-8-4-3-5-10-14-18(17)19/h3-15H,1H2,2H3 |
| InChIKey | VRALDTMNLPCRBX-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|