C22H33N3O5S — CID 164553270
N-[(2R,3S)-2-[[4-[2-(2-oxoethoxy)-3-pyridinyl]cyclohexyl]oxymethyl]piperidin-3-yl]cyclopropanesulfonamide (PubChem CID 164553270) has the molecular formula C22H33N3O5S and a molecular weight of 451.59 g/mol. Its IUPAC name is N-[(2R,3S)-2-[[4-[2-(2-oxoethoxy)-3-pyridinyl]cyclohexyl]oxymethyl]piperidin-3-yl]cyclopropanesulfonamide.
| Compound Name | N-[(2R,3S)-2-[[4-[2-(2-oxoethoxy)-3-pyridinyl]cyclohexyl]oxymethyl]piperidin-3-yl]cyclopropanesulfonamide |
|---|---|
| PubChem CID | 164553270 |
| Molecular Formula | C22H33N3O5S |
| Molecular Weight | 451.59 g/mol |
| Exact Mass | 451.21 |
| IUPAC Name | N-[(2R,3S)-2-[[4-[2-(2-oxoethoxy)-3-pyridinyl]cyclohexyl]oxymethyl]piperidin-3-yl]cyclopropanesulfonamide |
| SMILES | O=CCOc1ncccc1C1CCC(OC[C@@H]2NCCC[C@@H]2NS(=O)(=O)C2CC2)CC1 |
| InChI | InChI=1S/C22H33N3O5S/c26-13-14-29-22-19(3-1-12-24-22)16-5-7-17(8-6-16)30-15-21-20(4-2-11-23-21)25-31(27,28)18-9-10-18/h1,3,12-13,16-18,20-21,23,25H,2,4-11,14-15H2/t16?,17?,20-,21-/m0/s1 |
| InChIKey | FRUYTZGOWCWRJX-QGWLNKKWSA-N |
| XLogP | 1.90 |
| TPSA | 106.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.59 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|