C23H36N2O5S — CID 167117529
N-[(2R,3S)-2-[[4-[2-(2-oxoethoxy)phenyl]cyclohexyl]oxymethyl]piperidin-3-yl]propane-2-sulfonamide (PubChem CID 167117529) has the molecular formula C23H36N2O5S and a molecular weight of 452.62 g/mol. Its IUPAC name is N-[(2R,3S)-2-[[4-[2-(2-oxoethoxy)phenyl]cyclohexyl]oxymethyl]piperidin-3-yl]propane-2-sulfonamide.
| Compound Name | N-[(2R,3S)-2-[[4-[2-(2-oxoethoxy)phenyl]cyclohexyl]oxymethyl]piperidin-3-yl]propane-2-sulfonamide |
|---|---|
| PubChem CID | 167117529 |
| Molecular Formula | C23H36N2O5S |
| Molecular Weight | 452.62 g/mol |
| Exact Mass | 452.23 |
| IUPAC Name | N-[(2R,3S)-2-[[4-[2-(2-oxoethoxy)phenyl]cyclohexyl]oxymethyl]piperidin-3-yl]propane-2-sulfonamide |
| SMILES | CC(C)S(=O)(=O)N[C@H]1CCCN[C@H]1COC1CCC(c2ccccc2OCC=O)CC1 |
| InChI | InChI=1S/C23H36N2O5S/c1-17(2)31(27,28)25-21-7-5-13-24-22(21)16-30-19-11-9-18(10-12-19)20-6-3-4-8-23(20)29-15-14-26/h3-4,6,8,14,17-19,21-22,24-25H,5,7,9-13,15-16H2,1-2H3/t18?,19?,21-,22-/m0/s1 |
| InChIKey | XNLVKRVCNRDXIA-NZUHHQEFSA-N |
| XLogP | 2.76 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.62 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|