C26H38N2O5 — CID 166100557
(3R)-N-[(2R,3S)-2-[[4-[2-(2-oxoethoxy)phenyl]cyclohexyl]oxymethyl]piperidin-3-yl]oxane-3-carboxamide (PubChem CID 166100557) has the molecular formula C26H38N2O5 and a molecular weight of 458.60 g/mol. Its IUPAC name is (3R)-N-[(2R,3S)-2-[[4-[2-(2-oxoethoxy)phenyl]cyclohexyl]oxymethyl]piperidin-3-yl]oxane-3-carboxamide.
| Compound Name | (3R)-N-[(2R,3S)-2-[[4-[2-(2-oxoethoxy)phenyl]cyclohexyl]oxymethyl]piperidin-3-yl]oxane-3-carboxamide |
|---|---|
| PubChem CID | 166100557 |
| Molecular Formula | C26H38N2O5 |
| Molecular Weight | 458.60 g/mol |
| Exact Mass | 458.28 |
| IUPAC Name | (3R)-N-[(2R,3S)-2-[[4-[2-(2-oxoethoxy)phenyl]cyclohexyl]oxymethyl]piperidin-3-yl]oxane-3-carboxamide |
| SMILES | O=CCOc1ccccc1C1CCC(OC[C@@H]2NCCC[C@@H]2NC(=O)[C@@H]2CCCOC2)CC1 |
| InChI | InChI=1S/C26H38N2O5/c29-14-16-32-25-8-2-1-6-22(25)19-9-11-21(12-10-19)33-18-24-23(7-3-13-27-24)28-26(30)20-5-4-15-31-17-20/h1-2,6,8,14,19-21,23-24,27H,3-5,7,9-13,15-18H2,(H,28,30)/t19?,20-,21?,23+,24+/m1/s1 |
| InChIKey | WCDZXUDWKCXFHC-PHHQFMGESA-N |
| XLogP | 2.97 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.60 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|