C20H29NO5 — CID 170605373
2-[2-[4-[(3-hydroxypiperidin-2-yl)methoxy]cyclohexyl]phenoxy]acetic acid (PubChem CID 170605373) has the molecular formula C20H29NO5 and a molecular weight of 363.45 g/mol. Its IUPAC name is 2-[2-[4-[(3-hydroxypiperidin-2-yl)methoxy]cyclohexyl]phenoxy]acetic acid.
| Compound Name | 2-[2-[4-[(3-hydroxypiperidin-2-yl)methoxy]cyclohexyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 170605373 |
| Molecular Formula | C20H29NO5 |
| Molecular Weight | 363.45 g/mol |
| Exact Mass | 363.20 |
| IUPAC Name | 2-[2-[4-[(3-hydroxypiperidin-2-yl)methoxy]cyclohexyl]phenoxy]acetic acid |
| SMILES | O=C(O)COc1ccccc1C1CCC(OCC2NCCCC2O)CC1 |
| InChI | InChI=1S/C20H29NO5/c22-18-5-3-11-21-17(18)12-25-15-9-7-14(8-10-15)16-4-1-2-6-19(16)26-13-20(23)24/h1-2,4,6,14-15,17-18,21-22H,3,5,7-13H2,(H,23,24) |
| InChIKey | KHQRQOZDROUKHC-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.45 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |