C26H39N3O5 — CID 177003816
(2S)-4-methyl-N-[(2R,3S)-2-[[4-[2-(2-oxoethoxy)phenyl]cyclohexyl]oxymethyl]piperidin-3-yl]morpholine-2-carboxamide (PubChem CID 177003816) has the molecular formula C26H39N3O5 and a molecular weight of 473.61 g/mol. Its IUPAC name is (2S)-4-methyl-N-[(2R,3S)-2-[[4-[2-(2-oxoethoxy)phenyl]cyclohexyl]oxymethyl]piperidin-3-yl]morpholine-2-carboxamide.
| Compound Name | (2S)-4-methyl-N-[(2R,3S)-2-[[4-[2-(2-oxoethoxy)phenyl]cyclohexyl]oxymethyl]piperidin-3-yl]morpholine-2-carboxamide |
|---|---|
| PubChem CID | 177003816 |
| Molecular Formula | C26H39N3O5 |
| Molecular Weight | 473.61 g/mol |
| Exact Mass | 473.29 |
| IUPAC Name | (2S)-4-methyl-N-[(2R,3S)-2-[[4-[2-(2-oxoethoxy)phenyl]cyclohexyl]oxymethyl]piperidin-3-yl]morpholine-2-carboxamide |
| SMILES | CN1CCO[C@H](C(=O)N[C@H]2CCCN[C@H]2COC2CCC(c3ccccc3OCC=O)CC2)C1 |
| InChI | InChI=1S/C26H39N3O5/c1-29-13-15-32-25(17-29)26(31)28-22-6-4-12-27-23(22)18-34-20-10-8-19(9-11-20)21-5-2-3-7-24(21)33-16-14-30/h2-3,5,7,14,19-20,22-23,25,27H,4,6,8-13,15-18H2,1H3,(H,28,31)/t19?,20?,22-,23-,25-/m0/s1 |
| InChIKey | VXEJJHZBYZUDEG-ULZOVNINSA-N |
| XLogP | 1.87 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.61 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|