C24H35N3O5 — CID 166100538
N',N'-dimethyl-N-[(2R,3S)-2-[[4-[2-(2-oxoethoxy)phenyl]cyclohexyl]oxymethyl]piperidin-3-yl]oxamide (PubChem CID 166100538) has the molecular formula C24H35N3O5 and a molecular weight of 445.56 g/mol. Its IUPAC name is N',N'-dimethyl-N-[(2R,3S)-2-[[4-[2-(2-oxoethoxy)phenyl]cyclohexyl]oxymethyl]piperidin-3-yl]oxamide.
| Compound Name | N',N'-dimethyl-N-[(2R,3S)-2-[[4-[2-(2-oxoethoxy)phenyl]cyclohexyl]oxymethyl]piperidin-3-yl]oxamide |
|---|---|
| PubChem CID | 166100538 |
| Molecular Formula | C24H35N3O5 |
| Molecular Weight | 445.56 g/mol |
| Exact Mass | 445.26 |
| IUPAC Name | N',N'-dimethyl-N-[(2R,3S)-2-[[4-[2-(2-oxoethoxy)phenyl]cyclohexyl]oxymethyl]piperidin-3-yl]oxamide |
| SMILES | CN(C)C(=O)C(=O)N[C@H]1CCCN[C@H]1COC1CCC(c2ccccc2OCC=O)CC1 |
| InChI | InChI=1S/C24H35N3O5/c1-27(2)24(30)23(29)26-20-7-5-13-25-21(20)16-32-18-11-9-17(10-12-18)19-6-3-4-8-22(19)31-15-14-28/h3-4,6,8,14,17-18,20-21,25H,5,7,9-13,15-16H2,1-2H3,(H,26,29)/t17?,18?,20-,21-/m0/s1 |
| InChIKey | IFEUDFPYOURKPC-RQWVFBBXSA-N |
| XLogP | 1.63 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.56 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|