C16H27FN4O2 — CID 164560307
tert-butyl (4R)-3-(3-amino-5-tert-butylpyrazol-1-yl)-4-fluoropyrrolidine-1-carboxylate (PubChem CID 164560307) has the molecular formula C16H27FN4O2 and a molecular weight of 326.42 g/mol. Its IUPAC name is tert-butyl (4R)-3-(3-amino-5-tert-butylpyrazol-1-yl)-4-fluoropyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (4R)-3-(3-amino-5-tert-butylpyrazol-1-yl)-4-fluoropyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 164560307 |
| Molecular Formula | C16H27FN4O2 |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 326.21 |
| IUPAC Name | tert-butyl (4R)-3-(3-amino-5-tert-butylpyrazol-1-yl)-4-fluoropyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(n2nc(N)cc2C(C)(C)C)[C@H](F)C1 |
| InChI | InChI=1S/C16H27FN4O2/c1-15(2,3)12-7-13(18)19-21(12)11-9-20(8-10(11)17)14(22)23-16(4,5)6/h7,10-11H,8-9H2,1-6H3,(H2,18,19)/t10-,11?/m1/s1 |
| InChIKey | PYDPSVOYCQJPSF-NFJWQWPMSA-N |
| XLogP | 2.89 |
| TPSA | 73.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |