C13H18FN3O3 — CID 170257850
tert-butyl (3R,4R)-3-fluoro-4-(4-formylpyrazol-1-yl)pyrrolidine-1-carboxylate (PubChem CID 170257850) has the molecular formula C13H18FN3O3 and a molecular weight of 283.30 g/mol. Its IUPAC name is tert-butyl (3R,4R)-3-fluoro-4-(4-formylpyrazol-1-yl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3R,4R)-3-fluoro-4-(4-formylpyrazol-1-yl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 170257850 |
| Molecular Formula | C13H18FN3O3 |
| Molecular Weight | 283.30 g/mol |
| Exact Mass | 283.13 |
| IUPAC Name | tert-butyl (3R,4R)-3-fluoro-4-(4-formylpyrazol-1-yl)pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H](F)[C@H](n2cc(C=O)cn2)C1 |
| InChI | InChI=1S/C13H18FN3O3/c1-13(2,3)20-12(19)16-6-10(14)11(7-16)17-5-9(8-18)4-15-17/h4-5,8,10-11H,6-7H2,1-3H3/t10-,11-/m1/s1 |
| InChIKey | QIBMNHDAYNWDOV-GHMZBOCLSA-N |
| XLogP | 1.83 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.30 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|