C31H36FN9O2 — CID 164561858
2-diazenyl-N-methylaniline;(3E)-3-[2-(dimethylamino)ethylidene]-1-[4-(2-fluoro-4-methoxy-5-methylanilino)pyrido[3,4-d]pyrimidin-6-yl]-4-methylpyrrolidin-2-one (PubChem CID 164561858) has the molecular formula C31H36FN9O2 and a molecular weight of 585.69 g/mol. Its IUPAC name is 2-diazenyl-N-methylaniline;(3E)-3-[2-(dimethylamino)ethylidene]-1-[4-(2-fluoro-4-methoxy-5-methylanilino)pyrido[3,4-d]pyrimidin-6-yl]-4-methylpyrrolidin-2-one.
| Compound Name | 2-diazenyl-N-methylaniline;(3E)-3-[2-(dimethylamino)ethylidene]-1-[4-(2-fluoro-4-methoxy-5-methylanilino)pyrido[3,4-d]pyrimidin-6-yl]-4-methylpyrrolidin-2-one |
|---|---|
| PubChem CID | 164561858 |
| Molecular Formula | C31H36FN9O2 |
| Molecular Weight | 585.69 g/mol |
| Exact Mass | 585.30 |
| IUPAC Name | 2-diazenyl-N-methylaniline;(3E)-3-[2-(dimethylamino)ethylidene]-1-[4-(2-fluoro-4-methoxy-5-methylanilino)pyrido[3,4-d]pyrimidin-6-yl]-4-methylpyrrolidin-2-one |
| SMILES | COc1cc(F)c(Nc2ncnc3cnc(N4CC(C)/C(=C\CN(C)C)C4=O)cc23)cc1C.[H]/N=N/c1ccccc1NC |
| InChI | InChI=1S/C24H27FN6O2.C7H9N3/c1-14-8-19(18(25)10-21(14)33-5)29-23-17-9-22(26-11-20(17)27-13-28-23)31-12-15(2)16(24(31)32)6-7-30(3)4;1-9-6-4-2-3-5-7(6)10-8/h6,8-11,13,15H,7,12H2,1-5H3,(H,27,28,29);2-5,8-9H,1H3/b16-6+;10-8+ |
| InChIKey | YSMCQCIWPZMUMT-WYCZWWEDSA-N |
| XLogP | 6.09 |
| TPSA | 131.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.69 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|