C13H8N2O6 — CID 164562175
methyl 7-nitro-[1,4]benzodioxino[3,2-b]pyridine-8-carboxylate (PubChem CID 164562175) has the molecular formula C13H8N2O6 and a molecular weight of 288.22 g/mol. Its IUPAC name is methyl 7-nitro-[1,4]benzodioxino[3,2-b]pyridine-8-carboxylate.
| Compound Name | methyl 7-nitro-[1,4]benzodioxino[3,2-b]pyridine-8-carboxylate |
|---|---|
| PubChem CID | 164562175 |
| Molecular Formula | C13H8N2O6 |
| Molecular Weight | 288.22 g/mol |
| Exact Mass | 288.04 |
| IUPAC Name | methyl 7-nitro-[1,4]benzodioxino[3,2-b]pyridine-8-carboxylate |
| SMILES | COC(=O)c1cc2c(cc1[N+](=O)[O-])Oc1cccnc1O2 |
| InChI | InChI=1S/C13H8N2O6/c1-19-13(16)7-5-10-11(6-8(7)15(17)18)20-9-3-2-4-14-12(9)21-10/h2-6H,1H3 |
| InChIKey | GOTATWSXXXHCJS-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 100.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.22 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|