C11H5N3O6 — CID 10107435
7,8-dinitro-[1,4]benzodioxino[3,2-b]pyridine (PubChem CID 10107435) has the molecular formula C11H5N3O6 and a molecular weight of 275.18 g/mol. Its IUPAC name is 7,8-dinitro-[1,4]benzodioxino[3,2-b]pyridine.
| Compound Name | 7,8-dinitro-[1,4]benzodioxino[3,2-b]pyridine |
|---|---|
| PubChem CID | 10107435 |
| Molecular Formula | C11H5N3O6 |
| Molecular Weight | 275.18 g/mol |
| Exact Mass | 275.02 |
| IUPAC Name | 7,8-dinitro-[1,4]benzodioxino[3,2-b]pyridine |
| SMILES | O=[N+]([O-])c1cc2c(cc1[N+](=O)[O-])Oc1ncccc1O2 |
| InChI | InChI=1S/C11H5N3O6/c15-13(16)6-4-9-10(5-7(6)14(17)18)20-11-8(19-9)2-1-3-12-11/h1-5H |
| InChIKey | CDEFHMVGZCOMSD-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 117.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.18 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|