C26H26ClF3N6O3 — CID 164563122
7-[[(Z)-3-amino-3-(2-methylphenyl)prop-2-enylidene]amino]-5-[2-[5-chloro-2-(trifluoromethyl)phenyl]-5-methyl-1,2,4-triazol-3-yl]-3,3a,5,6,7,7a-hexahydro-2H-pyrano[2,3-d][1,2]oxazol-6-ol (PubChem CID 164563122) has the molecular formula C26H26ClF3N6O3 and a molecular weight of 562.98 g/mol. Its IUPAC name is 7-[[(Z)-3-amino-3-(2-methylphenyl)prop-2-enylidene]amino]-5-[2-[5-chloro-2-(trifluoromethyl)phenyl]-5-methyl-1,2,4-triazol-3-yl]-3,3a,5,6,7,7a-hexahydro-2H-pyrano[2,3-d][1,2]oxazol-6-ol.
| Compound Name | 7-[[(Z)-3-amino-3-(2-methylphenyl)prop-2-enylidene]amino]-5-[2-[5-chloro-2-(trifluoromethyl)phenyl]-5-methyl-1,2,4-triazol-3-yl]-3,3a,5,6,7,7a-hexahydro-2H-pyrano[2,3-d][1,2]oxazol-6-ol |
|---|---|
| PubChem CID | 164563122 |
| Molecular Formula | C26H26ClF3N6O3 |
| Molecular Weight | 562.98 g/mol |
| Exact Mass | 562.17 |
| IUPAC Name | 7-[[(Z)-3-amino-3-(2-methylphenyl)prop-2-enylidene]amino]-5-[2-[5-chloro-2-(trifluoromethyl)phenyl]-5-methyl-1,2,4-triazol-3-yl]-3,3a,5,6,7,7a-hexahydro-2H-pyrano[2,3-d][1,2]oxazol-6-ol |
| SMILES | Cc1nc(C2OC3CNOC3C(/N=C/C=C(\N)c3ccccc3C)C2O)n(-c2cc(Cl)ccc2C(F)(F)F)n1 |
| InChI | InChI=1S/C26H26ClF3N6O3/c1-13-5-3-4-6-16(13)18(31)9-10-32-21-22(37)24(38-20-12-33-39-23(20)21)25-34-14(2)35-36(25)19-11-15(27)7-8-17(19)26(28,29)30/h3-11,20-24,33,37H,12,31H2,1-2H3/b18-9-,32-10+ |
| InChIKey | GFBJSNFRKSSPBY-GPYNUAKOSA-N |
| XLogP | 3.70 |
| TPSA | 119.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.98 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|