C38H47N3O11S2 — CID 164569684
tert-butyl 2-[7-[4-[4-[2-[2-[2-(4-methylphenyl)sulfonyloxyethoxy]ethoxy]ethoxy]phenyl]piperidin-1-yl]sulfonyl-4-oxoquinazolin-3-yl]acetate (PubChem CID 164569684) has the molecular formula C38H47N3O11S2 and a molecular weight of 785.94 g/mol. Its IUPAC name is tert-butyl 2-[7-[4-[4-[2-[2-[2-(4-methylphenyl)sulfonyloxyethoxy]ethoxy]ethoxy]phenyl]piperidin-1-yl]sulfonyl-4-oxoquinazolin-3-yl]acetate.
| Compound Name | tert-butyl 2-[7-[4-[4-[2-[2-[2-(4-methylphenyl)sulfonyloxyethoxy]ethoxy]ethoxy]phenyl]piperidin-1-yl]sulfonyl-4-oxoquinazolin-3-yl]acetate |
|---|---|
| PubChem CID | 164569684 |
| Molecular Formula | C38H47N3O11S2 |
| Molecular Weight | 785.94 g/mol |
| Exact Mass | 785.27 |
| IUPAC Name | tert-butyl 2-[7-[4-[4-[2-[2-[2-(4-methylphenyl)sulfonyloxyethoxy]ethoxy]ethoxy]phenyl]piperidin-1-yl]sulfonyl-4-oxoquinazolin-3-yl]acetate |
| SMILES | Cc1ccc(S(=O)(=O)OCCOCCOCCOc2ccc(C3CCN(S(=O)(=O)c4ccc5c(=O)n(CC(=O)OC(C)(C)C)cnc5c4)CC3)cc2)cc1 |
| InChI | InChI=1S/C38H47N3O11S2/c1-28-5-11-32(12-6-28)54(46,47)51-24-22-49-20-19-48-21-23-50-31-9-7-29(8-10-31)30-15-17-41(18-16-30)53(44,45)33-13-14-34-35(25-33)39-27-40(37(34)43)26-36(42)52-38(2,3)4/h5-14,25,27,30H,15-24,26H2,1-4H3 |
| InChIKey | HVLCQIALVFOJLG-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 169.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 785.94 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|