C18H29NO2Si — CID 164583049
2-[(2R)-3-[tert-butyl(dimethyl)silyl]oxy-2-methylpropyl]-3H-isoindol-1-one (PubChem CID 164583049) has the molecular formula C18H29NO2Si and a molecular weight of 319.52 g/mol. Its IUPAC name is 2-[(2R)-3-[tert-butyl(dimethyl)silyl]oxy-2-methylpropyl]-3H-isoindol-1-one.
| Compound Name | 2-[(2R)-3-[tert-butyl(dimethyl)silyl]oxy-2-methylpropyl]-3H-isoindol-1-one |
|---|---|
| PubChem CID | 164583049 |
| Molecular Formula | C18H29NO2Si |
| Molecular Weight | 319.52 g/mol |
| Exact Mass | 319.20 |
| IUPAC Name | 2-[(2R)-3-[tert-butyl(dimethyl)silyl]oxy-2-methylpropyl]-3H-isoindol-1-one |
| SMILES | C[C@@H](CO[Si](C)(C)C(C)(C)C)CN1Cc2ccccc2C1=O |
| InChI | InChI=1S/C18H29NO2Si/c1-14(13-21-22(5,6)18(2,3)4)11-19-12-15-9-7-8-10-16(15)17(19)20/h7-10,14H,11-13H2,1-6H3/t14-/m1/s1 |
| InChIKey | ODGSQIALOFUIBX-CQSZACIVSA-N |
| XLogP | 4.30 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.52 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|