C25H37N3O4 — CID 164590156
(3S,6S,9aR)-2-acetyl-3-[(4-hydroxyphenyl)methyl]-8-(3-methylbutyl)-6-(2-methylpropyl)-3,6,9,9a-tetrahydro-1H-pyrazino[1,2-a]pyrazine-4,7-dione (PubChem CID 164590156) has the molecular formula C25H37N3O4 and a molecular weight of 443.59 g/mol. Its IUPAC name is (3S,6S,9aR)-2-acetyl-3-[(4-hydroxyphenyl)methyl]-8-(3-methylbutyl)-6-(2-methylpropyl)-3,6,9,9a-tetrahydro-1H-pyrazino[1,2-a]pyrazine-4,7-dione.
| Compound Name | (3S,6S,9aR)-2-acetyl-3-[(4-hydroxyphenyl)methyl]-8-(3-methylbutyl)-6-(2-methylpropyl)-3,6,9,9a-tetrahydro-1H-pyrazino[1,2-a]pyrazine-4,7-dione |
|---|---|
| PubChem CID | 164590156 |
| Molecular Formula | C25H37N3O4 |
| Molecular Weight | 443.59 g/mol |
| Exact Mass | 443.28 |
| IUPAC Name | (3S,6S,9aR)-2-acetyl-3-[(4-hydroxyphenyl)methyl]-8-(3-methylbutyl)-6-(2-methylpropyl)-3,6,9,9a-tetrahydro-1H-pyrazino[1,2-a]pyrazine-4,7-dione |
| SMILES | CC(=O)N1C[C@H]2CN(CCC(C)C)C(=O)[C@H](CC(C)C)N2C(=O)[C@@H]1Cc1ccc(O)cc1 |
| InChI | InChI=1S/C25H37N3O4/c1-16(2)10-11-26-14-20-15-27(18(5)29)22(13-19-6-8-21(30)9-7-19)25(32)28(20)23(24(26)31)12-17(3)4/h6-9,16-17,20,22-23,30H,10-15H2,1-5H3/t20-,22+,23+/m1/s1 |
| InChIKey | ZANUHWRFKFJBTC-PUHATCMVSA-N |
| XLogP | 2.67 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.59 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |