C13H16O4S — CID 164597223
3,4-diethyl-6-methoxy-2,1λ6-benzoxathiine 1,1-dioxide (PubChem CID 164597223) has the molecular formula C13H16O4S and a molecular weight of 268.33 g/mol. Its IUPAC name is 3,4-diethyl-6-methoxy-2,1λ6-benzoxathiine 1,1-dioxide.
| Compound Name | 3,4-diethyl-6-methoxy-2,1λ6-benzoxathiine 1,1-dioxide |
|---|---|
| PubChem CID | 164597223 |
| Molecular Formula | C13H16O4S |
| Molecular Weight | 268.33 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | 3,4-diethyl-6-methoxy-2,1λ6-benzoxathiine 1,1-dioxide |
| SMILES | CCC1=C(CC)c2cc(OC)ccc2S(=O)(=O)O1 |
| InChI | InChI=1S/C13H16O4S/c1-4-10-11-8-9(16-3)6-7-13(11)18(14,15)17-12(10)5-2/h6-8H,4-5H2,1-3H3 |
| InChIKey | DDMXQJQIFNNAMO-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.33 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|