C21H23F5O7 — CID 164597508
2-[2-[2-[4-methyl-2-oxo-3-(1,1,2,2,2-pentafluoroethyl)chromen-7-yl]oxyethoxy]ethoxy]ethyl propanoate (PubChem CID 164597508) has the molecular formula C21H23F5O7 and a molecular weight of 482.40 g/mol. Its IUPAC name is 2-[2-[2-[4-methyl-2-oxo-3-(1,1,2,2,2-pentafluoroethyl)chromen-7-yl]oxyethoxy]ethoxy]ethyl propanoate.
| Compound Name | 2-[2-[2-[4-methyl-2-oxo-3-(1,1,2,2,2-pentafluoroethyl)chromen-7-yl]oxyethoxy]ethoxy]ethyl propanoate |
|---|---|
| PubChem CID | 164597508 |
| Molecular Formula | C21H23F5O7 |
| Molecular Weight | 482.40 g/mol |
| Exact Mass | 482.14 |
| IUPAC Name | 2-[2-[2-[4-methyl-2-oxo-3-(1,1,2,2,2-pentafluoroethyl)chromen-7-yl]oxyethoxy]ethoxy]ethyl propanoate |
| SMILES | CCC(=O)OCCOCCOCCOc1ccc2c(C)c(C(F)(F)C(F)(F)F)c(=O)oc2c1 |
| InChI | InChI=1S/C21H23F5O7/c1-3-17(27)32-11-9-30-7-6-29-8-10-31-14-4-5-15-13(2)18(19(28)33-16(15)12-14)20(22,23)21(24,25)26/h4-5,12H,3,6-11H2,1-2H3 |
| InChIKey | KRSGQRGETPIIAG-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 84.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.40 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|