C11H11BrClN3O — CID 164601856
6-bromo-2-(chloromethyl)-1-[[(2S)-oxetan-2-yl]methyl]imidazo[4,5-b]pyridine (PubChem CID 164601856) has the molecular formula C11H11BrClN3O and a molecular weight of 316.59 g/mol. Its IUPAC name is 6-bromo-2-(chloromethyl)-1-[[(2S)-oxetan-2-yl]methyl]imidazo[4,5-b]pyridine.
| Compound Name | 6-bromo-2-(chloromethyl)-1-[[(2S)-oxetan-2-yl]methyl]imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 164601856 |
| Molecular Formula | C11H11BrClN3O |
| Molecular Weight | 316.59 g/mol |
| Exact Mass | 314.98 |
| IUPAC Name | 6-bromo-2-(chloromethyl)-1-[[(2S)-oxetan-2-yl]methyl]imidazo[4,5-b]pyridine |
| SMILES | ClCc1nc2ncc(Br)cc2n1C[C@@H]1CCO1 |
| InChI | InChI=1S/C11H11BrClN3O/c12-7-3-9-11(14-5-7)15-10(4-13)16(9)6-8-1-2-17-8/h3,5,8H,1-2,4,6H2/t8-/m0/s1 |
| InChIKey | MCZWYUYUWBZAQX-QMMMGPOBSA-N |
| XLogP | 2.72 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.59 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|