C34H43F4N5O3 — CID 164607954
N-[4-fluoro-5-[1-[1-(4-methoxyphenyl)ethyl]-3,6-dihydro-2H-pyridin-4-yl]-2-[(3S,5R)-3,4,5-trimethylpiperazin-1-yl]phenyl]-6-oxo-4-(trifluoromethyl)piperidine-3-carboxamide (PubChem CID 164607954) has the molecular formula C34H43F4N5O3 and a molecular weight of 645.74 g/mol. Its IUPAC name is N-[4-fluoro-5-[1-[1-(4-methoxyphenyl)ethyl]-3,6-dihydro-2H-pyridin-4-yl]-2-[(3S,5R)-3,4,5-trimethylpiperazin-1-yl]phenyl]-6-oxo-4-(trifluoromethyl)piperidine-3-carboxamide.
| Compound Name | N-[4-fluoro-5-[1-[1-(4-methoxyphenyl)ethyl]-3,6-dihydro-2H-pyridin-4-yl]-2-[(3S,5R)-3,4,5-trimethylpiperazin-1-yl]phenyl]-6-oxo-4-(trifluoromethyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 164607954 |
| Molecular Formula | C34H43F4N5O3 |
| Molecular Weight | 645.74 g/mol |
| Exact Mass | 645.33 |
| IUPAC Name | N-[4-fluoro-5-[1-[1-(4-methoxyphenyl)ethyl]-3,6-dihydro-2H-pyridin-4-yl]-2-[(3S,5R)-3,4,5-trimethylpiperazin-1-yl]phenyl]-6-oxo-4-(trifluoromethyl)piperidine-3-carboxamide |
| SMILES | COc1ccc(C(C)N2CC=C(c3cc(NC(=O)C4CNC(=O)CC4C(F)(F)F)c(N4C[C@@H](C)N(C)[C@@H](C)C4)cc3F)CC2)cc1 |
| InChI | InChI=1S/C34H43F4N5O3/c1-20-18-43(19-21(2)41(20)4)31-16-29(35)26(14-30(31)40-33(45)27-17-39-32(44)15-28(27)34(36,37)38)24-10-12-42(13-11-24)22(3)23-6-8-25(46-5)9-7-23/h6-10,14,16,20-22,27-28H,11-13,15,17-19H2,1-5H3,(H,39,44)(H,40,45)/t20-,21+,22?,27?,28? |
| InChIKey | KXNNHRIUTBJRAY-XWNCQBRHSA-N |
| XLogP | 5.47 |
| TPSA | 77.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.74 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|