C30H37F4N7O2 — CID 164607980
N-[4-fluoro-5-[1-(5-methylpyrimidin-2-yl)-3,6-dihydro-2H-pyridin-4-yl]-2-[(3R,5S)-3,4,5-trimethylpiperazin-1-yl]phenyl]-6-oxo-4-(trifluoromethyl)piperidine-3-carboxamide (PubChem CID 164607980) has the molecular formula C30H37F4N7O2 and a molecular weight of 603.67 g/mol. Its IUPAC name is N-[4-fluoro-5-[1-(5-methylpyrimidin-2-yl)-3,6-dihydro-2H-pyridin-4-yl]-2-[(3R,5S)-3,4,5-trimethylpiperazin-1-yl]phenyl]-6-oxo-4-(trifluoromethyl)piperidine-3-carboxamide.
| Compound Name | N-[4-fluoro-5-[1-(5-methylpyrimidin-2-yl)-3,6-dihydro-2H-pyridin-4-yl]-2-[(3R,5S)-3,4,5-trimethylpiperazin-1-yl]phenyl]-6-oxo-4-(trifluoromethyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 164607980 |
| Molecular Formula | C30H37F4N7O2 |
| Molecular Weight | 603.67 g/mol |
| Exact Mass | 603.29 |
| IUPAC Name | N-[4-fluoro-5-[1-(5-methylpyrimidin-2-yl)-3,6-dihydro-2H-pyridin-4-yl]-2-[(3R,5S)-3,4,5-trimethylpiperazin-1-yl]phenyl]-6-oxo-4-(trifluoromethyl)piperidine-3-carboxamide |
| SMILES | Cc1cnc(N2CC=C(c3cc(NC(=O)C4CNC(=O)CC4C(F)(F)F)c(N4C[C@@H](C)N(C)[C@@H](C)C4)cc3F)CC2)nc1 |
| InChI | InChI=1S/C30H37F4N7O2/c1-17-12-36-29(37-13-17)40-7-5-20(6-8-40)21-9-25(26(11-24(21)31)41-15-18(2)39(4)19(3)16-41)38-28(43)22-14-35-27(42)10-23(22)30(32,33)34/h5,9,11-13,18-19,22-23H,6-8,10,14-16H2,1-4H3,(H,35,42)(H,38,43)/t18-,19+,22?,23? |
| InChIKey | MPTXBKBCRIVVQD-MGAZVUHYSA-N |
| XLogP | 4.00 |
| TPSA | 93.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.67 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|