C32H39F4N7O4 — CID 164607984
ethyl 2-[4-[2-fluoro-5-[[6-oxo-4-(trifluoromethyl)piperidine-3-carbonyl]amino]-4-[(3R,5S)-3,4,5-trimethylpiperazin-1-yl]phenyl]-3,6-dihydro-2H-pyridin-1-yl]pyrimidine-4-carboxylate (PubChem CID 164607984) has the molecular formula C32H39F4N7O4 and a molecular weight of 661.70 g/mol. Its IUPAC name is ethyl 2-[4-[2-fluoro-5-[[6-oxo-4-(trifluoromethyl)piperidine-3-carbonyl]amino]-4-[(3R,5S)-3,4,5-trimethylpiperazin-1-yl]phenyl]-3,6-dihydro-2H-pyridin-1-yl]pyrimidine-4-carboxylate.
| Compound Name | ethyl 2-[4-[2-fluoro-5-[[6-oxo-4-(trifluoromethyl)piperidine-3-carbonyl]amino]-4-[(3R,5S)-3,4,5-trimethylpiperazin-1-yl]phenyl]-3,6-dihydro-2H-pyridin-1-yl]pyrimidine-4-carboxylate |
|---|---|
| PubChem CID | 164607984 |
| Molecular Formula | C32H39F4N7O4 |
| Molecular Weight | 661.70 g/mol |
| Exact Mass | 661.30 |
| IUPAC Name | ethyl 2-[4-[2-fluoro-5-[[6-oxo-4-(trifluoromethyl)piperidine-3-carbonyl]amino]-4-[(3R,5S)-3,4,5-trimethylpiperazin-1-yl]phenyl]-3,6-dihydro-2H-pyridin-1-yl]pyrimidine-4-carboxylate |
| SMILES | CCOC(=O)c1ccnc(N2CC=C(c3cc(NC(=O)C4CNC(=O)CC4C(F)(F)F)c(N4C[C@@H](C)N(C)[C@@H](C)C4)cc3F)CC2)n1 |
| InChI | InChI=1S/C32H39F4N7O4/c1-5-47-30(46)25-6-9-37-31(40-25)42-10-7-20(8-11-42)21-12-26(27(14-24(21)33)43-16-18(2)41(4)19(3)17-43)39-29(45)22-15-38-28(44)13-23(22)32(34,35)36/h6-7,9,12,14,18-19,22-23H,5,8,10-11,13,15-17H2,1-4H3,(H,38,44)(H,39,45)/t18-,19+,22?,23? |
| InChIKey | RDMRSWFMTHAWSO-MGAZVUHYSA-N |
| XLogP | 3.87 |
| TPSA | 120.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.70 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|