C31H37F4N7O2 — CID 164608009
N-[4-fluoro-5-(8-pyrimidin-2-yl-8-azabicyclo[3.2.1]oct-2-en-3-yl)-2-[(3S,5R)-3,4,5-trimethylpiperazin-1-yl]phenyl]-6-oxo-4-(trifluoromethyl)piperidine-3-carboxamide (PubChem CID 164608009) has the molecular formula C31H37F4N7O2 and a molecular weight of 615.68 g/mol. Its IUPAC name is N-[4-fluoro-5-(8-pyrimidin-2-yl-8-azabicyclo[3.2.1]oct-2-en-3-yl)-2-[(3S,5R)-3,4,5-trimethylpiperazin-1-yl]phenyl]-6-oxo-4-(trifluoromethyl)piperidine-3-carboxamide.
| Compound Name | N-[4-fluoro-5-(8-pyrimidin-2-yl-8-azabicyclo[3.2.1]oct-2-en-3-yl)-2-[(3S,5R)-3,4,5-trimethylpiperazin-1-yl]phenyl]-6-oxo-4-(trifluoromethyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 164608009 |
| Molecular Formula | C31H37F4N7O2 |
| Molecular Weight | 615.68 g/mol |
| Exact Mass | 615.29 |
| IUPAC Name | N-[4-fluoro-5-(8-pyrimidin-2-yl-8-azabicyclo[3.2.1]oct-2-en-3-yl)-2-[(3S,5R)-3,4,5-trimethylpiperazin-1-yl]phenyl]-6-oxo-4-(trifluoromethyl)piperidine-3-carboxamide |
| SMILES | C[C@@H]1CN(c2cc(F)c(C3=CC4CCC(C3)N4c3ncccn3)cc2NC(=O)C2CNC(=O)CC2C(F)(F)F)C[C@H](C)N1C |
| InChI | InChI=1S/C31H37F4N7O2/c1-17-15-41(16-18(2)40(17)3)27-13-25(32)22(19-9-20-5-6-21(10-19)42(20)30-36-7-4-8-37-30)11-26(27)39-29(44)23-14-38-28(43)12-24(23)31(33,34)35/h4,7-9,11,13,17-18,20-21,23-24H,5-6,10,12,14-16H2,1-3H3,(H,38,43)(H,39,44)/t17-,18+,20?,21?,23?,24? |
| InChIKey | HBXRCEPNHUFGSS-QDDFILGDSA-N |
| XLogP | 4.22 |
| TPSA | 93.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.68 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|