C17H18N6O4S2 — CID 164613176
ethyl 7-methyl-3-[(4-sulfamoylphenyl)carbamothioylamino]pyrazolo[1,5-a]pyrimidine-6-carboxylate (PubChem CID 164613176) has the molecular formula C17H18N6O4S2 and a molecular weight of 434.50 g/mol. Its IUPAC name is ethyl 7-methyl-3-[(4-sulfamoylphenyl)carbamothioylamino]pyrazolo[1,5-a]pyrimidine-6-carboxylate.
| Compound Name | ethyl 7-methyl-3-[(4-sulfamoylphenyl)carbamothioylamino]pyrazolo[1,5-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 164613176 |
| Molecular Formula | C17H18N6O4S2 |
| Molecular Weight | 434.50 g/mol |
| Exact Mass | 434.08 |
| IUPAC Name | ethyl 7-methyl-3-[(4-sulfamoylphenyl)carbamothioylamino]pyrazolo[1,5-a]pyrimidine-6-carboxylate |
| SMILES | CCOC(=O)c1cnc2c(NC(=S)Nc3ccc(S(N)(=O)=O)cc3)cnn2c1C |
| InChI | InChI=1S/C17H18N6O4S2/c1-3-27-16(24)13-8-19-15-14(9-20-23(15)10(13)2)22-17(28)21-11-4-6-12(7-5-11)29(18,25)26/h4-9H,3H2,1-2H3,(H2,18,25,26)(H2,21,22,28) |
| InChIKey | YTHGUKNIARZOBD-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 140.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.50 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|