About 4-[(4-benzyl-2,5-dioxo-3-propylimidazolidin-1-yl)methyl]-N-hydroxybenzamide
4-[(4-benzyl-2,5-dioxo-3-propylimidazolidin-1-yl)methyl]-N-hydroxybenzamide (PubChem CID 164617342) has the molecular formula C21H23N3O4
and a molecular weight of 381.43 g/mol. Its IUPAC name is 4-[(4-benzyl-2,5-dioxo-3-propylimidazolidin-1-yl)methyl]-N-hydroxybenzamide.
Molecular Properties
| Compound Name | 4-[(4-benzyl-2,5-dioxo-3-propylimidazolidin-1-yl)methyl]-N-hydroxybenzamide |
| PubChem CID | 164617342 |
| Molecular Formula | C21H23N3O4 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | 4-[(4-benzyl-2,5-dioxo-3-propylimidazolidin-1-yl)methyl]-N-hydroxybenzamide |
| SMILES | CCCN1C(=O)N(Cc2ccc(C(=O)NO)cc2)C(=O)C1Cc1ccccc1 |
| InChI | InChI=1S/C21H23N3O4/c1-2-12-23-18(13-15-6-4-3-5-7-15)20(26)24(21(23)27)14-16-8-10-17(11-9-16)19(25)22-28/h3-11,18,28H,2,12-14H2,1H3,(H,22,25) |
| InChIKey | DGZGTDNFFJVALJ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-[(4-benzyl-2,5-dioxo-3-propylimidazolidin-1-yl)methyl]-N-hydroxybenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(4-benzyl-2,5-dioxo-3-propylimidazolidin-1-yl)methyl]-N-hydroxybenzamide?
The IUPAC name of 4-[(4-benzyl-2,5-dioxo-3-propylimidazolidin-1-yl)methyl]-N-hydroxybenzamide (CID 164617342) is 4-[(4-benzyl-2,5-dioxo-3-propylimidazolidin-1-yl)methyl]-N-hydroxybenzamide.
What is the SMILES notation for 4-[(4-benzyl-2,5-dioxo-3-propylimidazolidin-1-yl)methyl]-N-hydroxybenzamide?
The canonical SMILES for 4-[(4-benzyl-2,5-dioxo-3-propylimidazolidin-1-yl)methyl]-N-hydroxybenzamide is CCCN1C(=O)N(Cc2ccc(C(=O)NO)cc2)C(=O)C1Cc1ccccc1.
What is the InChIKey of 4-[(4-benzyl-2,5-dioxo-3-propylimidazolidin-1-yl)methyl]-N-hydroxybenzamide?
The InChIKey is DGZGTDNFFJVALJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H23N3O4/c1-2-12-23-18(13-15-6-4-3-5-7-15)20(26)24(21(23)27)14-16-8-10-17(11-9-16)19(25)22-28/h3-11,18,28H,2,12-14H2,1H3,(H,22,25).
What are the key properties of 4-[(4-benzyl-2,5-dioxo-3-propylimidazolidin-1-yl)methyl]-N-hydroxybenzamide?
4-[(4-benzyl-2,5-dioxo-3-propylimidazolidin-1-yl)methyl]-N-hydroxybenzamide has a molecular weight of 381.43 g/mol, XLogP of 2.59, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(4-benzyl-2,5-dioxo-3-propylimidazolidin-1-yl)methyl]-N-hydroxybenzamide is sourced from PubChem (CID 164617342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).