C26H40O2 — CID 164617802
(2R,4aS,8aS)-1-[(E,3R)-3-hydroxy-3-methyl-5-phenylpent-4-enyl]-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-2-ol (PubChem CID 164617802) has the molecular formula C26H40O2 and a molecular weight of 384.60 g/mol. Its IUPAC name is (2R,4aS,8aS)-1-[(E,3R)-3-hydroxy-3-methyl-5-phenylpent-4-enyl]-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-2-ol.
| Compound Name | (2R,4aS,8aS)-1-[(E,3R)-3-hydroxy-3-methyl-5-phenylpent-4-enyl]-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-2-ol |
|---|---|
| PubChem CID | 164617802 |
| Molecular Formula | C26H40O2 |
| Molecular Weight | 384.60 g/mol |
| Exact Mass | 384.30 |
| IUPAC Name | (2R,4aS,8aS)-1-[(E,3R)-3-hydroxy-3-methyl-5-phenylpent-4-enyl]-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-2-ol |
| SMILES | CC1(C)CCC[C@]2(C)C(CC[C@@](C)(O)/C=C/c3ccccc3)[C@](C)(O)CC[C@@H]12 |
| InChI | InChI=1S/C26H40O2/c1-23(2)15-9-16-25(4)21(23)14-19-26(5,28)22(25)13-18-24(3,27)17-12-20-10-7-6-8-11-20/h6-8,10-12,17,21-22,27-28H,9,13-16,18-19H2,1-5H3/b17-12+/t21-,22?,24-,25-,26+/m0/s1 |
| InChIKey | VELIILJQNQRPGY-MRHJMSHVSA-N |
| XLogP | 6.22 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.60 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |