C32H31FN6O4 — CID 164620662
1-N'-(4-fluorophenyl)-1-N-[4-[2-[3-(morpholin-4-ylmethyl)anilino]pyrimidin-4-yl]oxyphenyl]cyclopropane-1,1-dicarboxamide (PubChem CID 164620662) has the molecular formula C32H31FN6O4 and a molecular weight of 582.64 g/mol. Its IUPAC name is 1-N'-(4-fluorophenyl)-1-N-[4-[2-[3-(morpholin-4-ylmethyl)anilino]pyrimidin-4-yl]oxyphenyl]cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N'-(4-fluorophenyl)-1-N-[4-[2-[3-(morpholin-4-ylmethyl)anilino]pyrimidin-4-yl]oxyphenyl]cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 164620662 |
| Molecular Formula | C32H31FN6O4 |
| Molecular Weight | 582.64 g/mol |
| Exact Mass | 582.24 |
| IUPAC Name | 1-N'-(4-fluorophenyl)-1-N-[4-[2-[3-(morpholin-4-ylmethyl)anilino]pyrimidin-4-yl]oxyphenyl]cyclopropane-1,1-dicarboxamide |
| SMILES | O=C(Nc1ccc(F)cc1)C1(C(=O)Nc2ccc(Oc3ccnc(Nc4cccc(CN5CCOCC5)c4)n3)cc2)CC1 |
| InChI | InChI=1S/C32H31FN6O4/c33-23-4-6-24(7-5-23)35-29(40)32(13-14-32)30(41)36-25-8-10-27(11-9-25)43-28-12-15-34-31(38-28)37-26-3-1-2-22(20-26)21-39-16-18-42-19-17-39/h1-12,15,20H,13-14,16-19,21H2,(H,35,40)(H,36,41)(H,34,37,38) |
| InChIKey | MKOIMJPCFQKTIB-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 117.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.64 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|