C23H24N2O5 — CID 164628287
1-[4-[(3-hydroxy-2-methoxynaphtho[2,1-f][1,3]benzodioxol-5-yl)methyl]piperazin-1-yl]ethanone (PubChem CID 164628287) has the molecular formula C23H24N2O5 and a molecular weight of 408.45 g/mol. Its IUPAC name is 1-[4-[(3-hydroxy-2-methoxynaphtho[2,1-f][1,3]benzodioxol-5-yl)methyl]piperazin-1-yl]ethanone.
| Compound Name | 1-[4-[(3-hydroxy-2-methoxynaphtho[2,1-f][1,3]benzodioxol-5-yl)methyl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 164628287 |
| Molecular Formula | C23H24N2O5 |
| Molecular Weight | 408.45 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | 1-[4-[(3-hydroxy-2-methoxynaphtho[2,1-f][1,3]benzodioxol-5-yl)methyl]piperazin-1-yl]ethanone |
| SMILES | COc1cc2c(cc1O)c(CN1CCN(C(C)=O)CC1)cc1cc3c(cc12)OCO3 |
| InChI | InChI=1S/C23H24N2O5/c1-14(26)25-5-3-24(4-6-25)12-16-7-15-8-22-23(30-13-29-22)10-18(15)19-11-21(28-2)20(27)9-17(16)19/h7-11,27H,3-6,12-13H2,1-2H3 |
| InChIKey | SZALPMGTUZKHEF-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 71.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.45 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|