C20H26N4O2S — CID 164629643
3-[1-[(1S,2R)-2-phenylcyclopropyl]sulfonylpiperidin-4-yl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine (PubChem CID 164629643) has the molecular formula C20H26N4O2S and a molecular weight of 386.52 g/mol. Its IUPAC name is 3-[1-[(1S,2R)-2-phenylcyclopropyl]sulfonylpiperidin-4-yl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine.
| Compound Name | 3-[1-[(1S,2R)-2-phenylcyclopropyl]sulfonylpiperidin-4-yl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine |
|---|---|
| PubChem CID | 164629643 |
| Molecular Formula | C20H26N4O2S |
| Molecular Weight | 386.52 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | 3-[1-[(1S,2R)-2-phenylcyclopropyl]sulfonylpiperidin-4-yl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine |
| SMILES | O=S(=O)([C@H]1C[C@@H]1c1ccccc1)N1CCC(c2nnc3n2CCCC3)CC1 |
| InChI | InChI=1S/C20H26N4O2S/c25-27(26,18-14-17(18)15-6-2-1-3-7-15)23-12-9-16(10-13-23)20-22-21-19-8-4-5-11-24(19)20/h1-3,6-7,16-18H,4-5,8-14H2/t17-,18+/m1/s1 |
| InChIKey | MDHXJWVXWWZKRW-MSOLQXFVSA-N |
| XLogP | 2.68 |
| TPSA | 68.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.52 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |