C14H13FN2O4 — CID 164630453
N-[(3S)-3-carbamoyloxolan-3-yl]-6-fluoro-1-benzofuran-3-carboxamide (PubChem CID 164630453) has the molecular formula C14H13FN2O4 and a molecular weight of 292.27 g/mol. Its IUPAC name is N-[(3S)-3-carbamoyloxolan-3-yl]-6-fluoro-1-benzofuran-3-carboxamide.
| Compound Name | N-[(3S)-3-carbamoyloxolan-3-yl]-6-fluoro-1-benzofuran-3-carboxamide |
|---|---|
| PubChem CID | 164630453 |
| Molecular Formula | C14H13FN2O4 |
| Molecular Weight | 292.27 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | N-[(3S)-3-carbamoyloxolan-3-yl]-6-fluoro-1-benzofuran-3-carboxamide |
| SMILES | NC(=O)[C@]1(NC(=O)c2coc3cc(F)ccc23)CCOC1 |
| InChI | InChI=1S/C14H13FN2O4/c15-8-1-2-9-10(6-21-11(9)5-8)12(18)17-14(13(16)19)3-4-20-7-14/h1-2,5-6H,3-4,7H2,(H2,16,19)(H,17,18)/t14-/m0/s1 |
| InChIKey | XRROKVDPLODDMM-AWEZNQCLSA-N |
| XLogP | 0.95 |
| TPSA | 94.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.27 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |