C9H11ClFN3 — CID 164645238
5-chloro-2-fluoro-N-[(E)-pent-2-enyl]pyrimidin-4-amine (PubChem CID 164645238) has the molecular formula C9H11ClFN3 and a molecular weight of 215.66 g/mol. Its IUPAC name is 5-chloro-2-fluoro-N-[(E)-pent-2-enyl]pyrimidin-4-amine.
| Compound Name | 5-chloro-2-fluoro-N-[(E)-pent-2-enyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 164645238 |
| Molecular Formula | C9H11ClFN3 |
| Molecular Weight | 215.66 g/mol |
| Exact Mass | 215.06 |
| IUPAC Name | 5-chloro-2-fluoro-N-[(E)-pent-2-enyl]pyrimidin-4-amine |
| SMILES | CC/C=C/CNc1nc(F)ncc1Cl |
| InChI | InChI=1S/C9H11ClFN3/c1-2-3-4-5-12-8-7(10)6-13-9(11)14-8/h3-4,6H,2,5H2,1H3,(H,12,13,14)/b4-3+ |
| InChIKey | WSEVAPAIEXCTKB-ONEGZZNKSA-N |
| XLogP | 2.65 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.66 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|