C9H9BrN2OS — CID 164656619
4-bromo-N-pent-3-ynyl-1,2-thiazole-3-carboxamide (PubChem CID 164656619) has the molecular formula C9H9BrN2OS and a molecular weight of 273.16 g/mol. Its IUPAC name is 4-bromo-N-pent-3-ynyl-1,2-thiazole-3-carboxamide.
| Compound Name | 4-bromo-N-pent-3-ynyl-1,2-thiazole-3-carboxamide |
|---|---|
| PubChem CID | 164656619 |
| Molecular Formula | C9H9BrN2OS |
| Molecular Weight | 273.16 g/mol |
| Exact Mass | 271.96 |
| IUPAC Name | 4-bromo-N-pent-3-ynyl-1,2-thiazole-3-carboxamide |
| SMILES | CC#CCCNC(=O)c1nscc1Br |
| InChI | InChI=1S/C9H9BrN2OS/c1-2-3-4-5-11-9(13)8-7(10)6-14-12-8/h6H,4-5H2,1H3,(H,11,13) |
| InChIKey | KFCOWCOOCVJXDE-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.16 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|