About 4-bromo-N-(2-fluoroethyl)-1,2-thiazole-3-carboxamide
4-bromo-N-(2-fluoroethyl)-1,2-thiazole-3-carboxamide (PubChem CID 164656626) has the molecular formula C6H6BrFN2OS
and a molecular weight of 253.10 g/mol. Its IUPAC name is 4-bromo-N-(2-fluoroethyl)-1,2-thiazole-3-carboxamide.
Molecular Properties
| Compound Name | 4-bromo-N-(2-fluoroethyl)-1,2-thiazole-3-carboxamide |
| PubChem CID | 164656626 |
| Molecular Formula | C6H6BrFN2OS |
| Molecular Weight | 253.10 g/mol |
| Exact Mass | 251.94 |
| IUPAC Name | 4-bromo-N-(2-fluoroethyl)-1,2-thiazole-3-carboxamide |
| SMILES | O=C(NCCF)c1nscc1Br |
| InChI | InChI=1S/C6H6BrFN2OS/c7-4-3-12-10-5(4)6(11)9-2-1-8/h3H,1-2H2,(H,9,11) |
| InChIKey | HAPAQJJJMJYWJX-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.10 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-bromo-N-(2-fluoroethyl)-1,2-thiazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-N-(2-fluoroethyl)-1,2-thiazole-3-carboxamide?
The IUPAC name of 4-bromo-N-(2-fluoroethyl)-1,2-thiazole-3-carboxamide (CID 164656626) is 4-bromo-N-(2-fluoroethyl)-1,2-thiazole-3-carboxamide.
What is the SMILES notation for 4-bromo-N-(2-fluoroethyl)-1,2-thiazole-3-carboxamide?
The canonical SMILES for 4-bromo-N-(2-fluoroethyl)-1,2-thiazole-3-carboxamide is O=C(NCCF)c1nscc1Br.
What is the InChIKey of 4-bromo-N-(2-fluoroethyl)-1,2-thiazole-3-carboxamide?
The InChIKey is HAPAQJJJMJYWJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6BrFN2OS/c7-4-3-12-10-5(4)6(11)9-2-1-8/h3H,1-2H2,(H,9,11).
What are the key properties of 4-bromo-N-(2-fluoroethyl)-1,2-thiazole-3-carboxamide?
4-bromo-N-(2-fluoroethyl)-1,2-thiazole-3-carboxamide has a molecular weight of 253.10 g/mol, XLogP of 1.60, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-N-(2-fluoroethyl)-1,2-thiazole-3-carboxamide is sourced from PubChem (CID 164656626), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).