C7H12N2OS — CID 164661969
(2R)-2-amino-1-(1,2-thiazol-5-yl)butan-1-ol (PubChem CID 164661969) has the molecular formula C7H12N2OS and a molecular weight of 172.25 g/mol. Its IUPAC name is (2R)-2-amino-1-(1,2-thiazol-5-yl)butan-1-ol.
| Compound Name | (2R)-2-amino-1-(1,2-thiazol-5-yl)butan-1-ol |
|---|---|
| PubChem CID | 164661969 |
| Molecular Formula | C7H12N2OS |
| Molecular Weight | 172.25 g/mol |
| Exact Mass | 172.07 |
| IUPAC Name | (2R)-2-amino-1-(1,2-thiazol-5-yl)butan-1-ol |
| SMILES | CC[C@@H](N)C(O)c1ccns1 |
| InChI | InChI=1S/C7H12N2OS/c1-2-5(8)7(10)6-3-4-9-11-6/h3-5,7,10H,2,8H2,1H3/t5-,7?/m1/s1 |
| InChIKey | FHNXNVXJJGMNCM-FOUAAFFMSA-N |
| XLogP | 0.91 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.25 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |