C18H27N3O5S2 — CID 164663297
2-[(1,1-dioxothiolan-3-yl)-[(1,1-dioxothiolan-3-yl)amino]amino]-N-(3-ethylphenyl)acetamide (PubChem CID 164663297) has the molecular formula C18H27N3O5S2 and a molecular weight of 429.56 g/mol. Its IUPAC name is 2-[(1,1-dioxothiolan-3-yl)-[(1,1-dioxothiolan-3-yl)amino]amino]-N-(3-ethylphenyl)acetamide.
| Compound Name | 2-[(1,1-dioxothiolan-3-yl)-[(1,1-dioxothiolan-3-yl)amino]amino]-N-(3-ethylphenyl)acetamide |
|---|---|
| PubChem CID | 164663297 |
| Molecular Formula | C18H27N3O5S2 |
| Molecular Weight | 429.56 g/mol |
| Exact Mass | 429.14 |
| IUPAC Name | 2-[(1,1-dioxothiolan-3-yl)-[(1,1-dioxothiolan-3-yl)amino]amino]-N-(3-ethylphenyl)acetamide |
| SMILES | CCc1cccc(NC(=O)CN(NC2CCS(=O)(=O)C2)C2CCS(=O)(=O)C2)c1 |
| InChI | InChI=1S/C18H27N3O5S2/c1-2-14-4-3-5-15(10-14)19-18(22)11-21(17-7-9-28(25,26)13-17)20-16-6-8-27(23,24)12-16/h3-5,10,16-17,20H,2,6-9,11-13H2,1H3,(H,19,22) |
| InChIKey | XSJGVFGHZOMICY-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.56 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|