C27H25BrO8 — CID 164669923
[(3R,4R,6R)-6-(1-acetyloxy-6-bromo-5,8-dioxonaphthalen-2-yl)-2-methyl-3-phenylmethoxyoxan-4-yl] acetate (PubChem CID 164669923) has the molecular formula C27H25BrO8 and a molecular weight of 557.39 g/mol. Its IUPAC name is [(3R,4R,6R)-6-(1-acetyloxy-6-bromo-5,8-dioxonaphthalen-2-yl)-2-methyl-3-phenylmethoxyoxan-4-yl] acetate.
| Compound Name | [(3R,4R,6R)-6-(1-acetyloxy-6-bromo-5,8-dioxonaphthalen-2-yl)-2-methyl-3-phenylmethoxyoxan-4-yl] acetate |
|---|---|
| PubChem CID | 164669923 |
| Molecular Formula | C27H25BrO8 |
| Molecular Weight | 557.39 g/mol |
| Exact Mass | 556.07 |
| IUPAC Name | [(3R,4R,6R)-6-(1-acetyloxy-6-bromo-5,8-dioxonaphthalen-2-yl)-2-methyl-3-phenylmethoxyoxan-4-yl] acetate |
| SMILES | CC(=O)Oc1c([C@H]2C[C@@H](OC(C)=O)[C@H](OCc3ccccc3)C(C)O2)ccc2c1C(=O)C=C(Br)C2=O |
| InChI | InChI=1S/C27H25BrO8/c1-14-26(33-13-17-7-5-4-6-8-17)23(35-15(2)29)12-22(34-14)18-9-10-19-24(27(18)36-16(3)30)21(31)11-20(28)25(19)32/h4-11,14,22-23,26H,12-13H2,1-3H3/t14?,22-,23-,26-/m1/s1 |
| InChIKey | LPRJHWXEPWFGQV-WGGGDYLXSA-N |
| XLogP | 4.64 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.39 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|