C17H25O2P — CID 164671867
[(E)-3-[cyclohexyloxy(ethyl)phosphoryl]prop-1-enyl]benzene (PubChem CID 164671867) has the molecular formula C17H25O2P and a molecular weight of 292.36 g/mol. Its IUPAC name is [(E)-3-[cyclohexyloxy(ethyl)phosphoryl]prop-1-enyl]benzene.
| Compound Name | [(E)-3-[cyclohexyloxy(ethyl)phosphoryl]prop-1-enyl]benzene |
|---|---|
| PubChem CID | 164671867 |
| Molecular Formula | C17H25O2P |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.16 |
| IUPAC Name | [(E)-3-[cyclohexyloxy(ethyl)phosphoryl]prop-1-enyl]benzene |
| SMILES | CC[P@@](=O)(C/C=C/c1ccccc1)OC1CCCCC1 |
| InChI | InChI=1S/C17H25O2P/c1-2-20(18,19-17-13-7-4-8-14-17)15-9-12-16-10-5-3-6-11-16/h3,5-6,9-12,17H,2,4,7-8,13-15H2,1H3/b12-9+/t20-/m0/s1 |
| InChIKey | NRACGRJIRLMPFC-JTPHSUOKSA-N |
| XLogP | 5.35 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|