C17H23N3O5S — CID 164673496
methyl (2S)-2-[[2-[[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]amino]ethanethioyl]amino]propanoate (PubChem CID 164673496) has the molecular formula C17H23N3O5S and a molecular weight of 381.45 g/mol. Its IUPAC name is methyl (2S)-2-[[2-[[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]amino]ethanethioyl]amino]propanoate.
| Compound Name | methyl (2S)-2-[[2-[[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]amino]ethanethioyl]amino]propanoate |
|---|---|
| PubChem CID | 164673496 |
| Molecular Formula | C17H23N3O5S |
| Molecular Weight | 381.45 g/mol |
| Exact Mass | 381.14 |
| IUPAC Name | methyl (2S)-2-[[2-[[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]amino]ethanethioyl]amino]propanoate |
| SMILES | COC(=O)[C@H](C)NC(=S)CNC(=O)[C@H](C)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C17H23N3O5S/c1-11(20-17(23)25-10-13-7-5-4-6-8-13)15(21)18-9-14(26)19-12(2)16(22)24-3/h4-8,11-12H,9-10H2,1-3H3,(H,18,21)(H,19,26)(H,20,23)/t11-,12-/m0/s1 |
| InChIKey | JEKNJHOHVWVJMR-RYUDHWBXSA-N |
| XLogP | 0.90 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.45 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|