C39H51IO8 — CID 164674683
(1R,3R,4E,6S,7R,11S,13S,17S)-7-[(E)-2-iodoethenyl]-11,13-bis[(4-methoxyphenyl)methoxy]-3,6-dimethyl-8,21-dioxabicyclo[15.3.1]henicos-4-ene-9,15-dione (PubChem CID 164674683) has the molecular formula C39H51IO8 and a molecular weight of 774.73 g/mol. Its IUPAC name is (1R,3R,4E,6S,7R,11S,13S,17S)-7-[(E)-2-iodoethenyl]-11,13-bis[(4-methoxyphenyl)methoxy]-3,6-dimethyl-8,21-dioxabicyclo[15.3.1]henicos-4-ene-9,15-dione.
| Compound Name | (1R,3R,4E,6S,7R,11S,13S,17S)-7-[(E)-2-iodoethenyl]-11,13-bis[(4-methoxyphenyl)methoxy]-3,6-dimethyl-8,21-dioxabicyclo[15.3.1]henicos-4-ene-9,15-dione |
|---|---|
| PubChem CID | 164674683 |
| Molecular Formula | C39H51IO8 |
| Molecular Weight | 774.73 g/mol |
| Exact Mass | 774.26 |
| IUPAC Name | (1R,3R,4E,6S,7R,11S,13S,17S)-7-[(E)-2-iodoethenyl]-11,13-bis[(4-methoxyphenyl)methoxy]-3,6-dimethyl-8,21-dioxabicyclo[15.3.1]henicos-4-ene-9,15-dione |
| SMILES | COc1ccc(CO[C@@H]2CC(=O)C[C@@H]3CCC[C@H](C[C@@H](C)/C=C/[C@H](C)[C@H](/C=C/I)OC(=O)C[C@@H](OCc4ccc(OC)cc4)C2)O3)cc1 |
| InChI | InChI=1S/C39H51IO8/c1-27-8-9-28(2)38(18-19-40)48-39(42)24-37(46-26-30-12-16-33(44-4)17-13-30)23-36(45-25-29-10-14-32(43-3)15-11-29)22-31(41)21-35-7-5-6-34(20-27)47-35/h8-19,27-28,34-38H,5-7,20-26H2,1-4H3/b9-8+,19-18+/t27-,28-,34+,35-,36+,37-,38-/m0/s1 |
| InChIKey | AOYVSSSBDUTGAY-ABBPBULXSA-N |
| XLogP | 8.33 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 774.73 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|