C18H15BrN2O3S — CID 164679221
N-(5-bromo-3-formylquinolin-2-yl)-N,4-dimethylbenzenesulfonamide (PubChem CID 164679221) has the molecular formula C18H15BrN2O3S and a molecular weight of 419.30 g/mol. Its IUPAC name is N-(5-bromo-3-formylquinolin-2-yl)-N,4-dimethylbenzenesulfonamide.
| Compound Name | N-(5-bromo-3-formylquinolin-2-yl)-N,4-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 164679221 |
| Molecular Formula | C18H15BrN2O3S |
| Molecular Weight | 419.30 g/mol |
| Exact Mass | 418.00 |
| IUPAC Name | N-(5-bromo-3-formylquinolin-2-yl)-N,4-dimethylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N(C)c2nc3cccc(Br)c3cc2C=O)cc1 |
| InChI | InChI=1S/C18H15BrN2O3S/c1-12-6-8-14(9-7-12)25(23,24)21(2)18-13(11-22)10-15-16(19)4-3-5-17(15)20-18/h3-11H,1-2H3 |
| InChIKey | YEESFGILGZBROF-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 67.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.30 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|