C25H32O3 — CID 164680708
tert-butyl (2R,3S)-3-hexyl-2-phenyl-2H-1-benzofuran-3-carboxylate (PubChem CID 164680708) has the molecular formula C25H32O3 and a molecular weight of 380.53 g/mol. Its IUPAC name is tert-butyl (2R,3S)-3-hexyl-2-phenyl-2H-1-benzofuran-3-carboxylate.
| Compound Name | tert-butyl (2R,3S)-3-hexyl-2-phenyl-2H-1-benzofuran-3-carboxylate |
|---|---|
| PubChem CID | 164680708 |
| Molecular Formula | C25H32O3 |
| Molecular Weight | 380.53 g/mol |
| Exact Mass | 380.24 |
| IUPAC Name | tert-butyl (2R,3S)-3-hexyl-2-phenyl-2H-1-benzofuran-3-carboxylate |
| SMILES | CCCCCC[C@]1(C(=O)OC(C)(C)C)c2ccccc2O[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C25H32O3/c1-5-6-7-13-18-25(23(26)28-24(2,3)4)20-16-11-12-17-21(20)27-22(25)19-14-9-8-10-15-19/h8-12,14-17,22H,5-7,13,18H2,1-4H3/t22-,25+/m1/s1 |
| InChIKey | JCYAPHPZSABSDS-RDGATRHJSA-N |
| XLogP | 6.37 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.53 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|