C20H24O4 — CID 164681216
(1S,2S,10S,11R)-15-hydroxy-6-methoxy-7,14-dimethyl-1-prop-2-enyl-12-oxatetracyclo[9.2.2.02,10.03,8]pentadeca-3(8),4,6-trien-13-one (PubChem CID 164681216) has the molecular formula C20H24O4 and a molecular weight of 328.41 g/mol. Its IUPAC name is (1S,2S,10S,11R)-15-hydroxy-6-methoxy-7,14-dimethyl-1-prop-2-enyl-12-oxatetracyclo[9.2.2.02,10.03,8]pentadeca-3(8),4,6-trien-13-one.
| Compound Name | (1S,2S,10S,11R)-15-hydroxy-6-methoxy-7,14-dimethyl-1-prop-2-enyl-12-oxatetracyclo[9.2.2.02,10.03,8]pentadeca-3(8),4,6-trien-13-one |
|---|---|
| PubChem CID | 164681216 |
| Molecular Formula | C20H24O4 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | (1S,2S,10S,11R)-15-hydroxy-6-methoxy-7,14-dimethyl-1-prop-2-enyl-12-oxatetracyclo[9.2.2.02,10.03,8]pentadeca-3(8),4,6-trien-13-one |
| SMILES | C=CC[C@@]12C(=O)O[C@@H](C(O)C1C)[C@H]1Cc3c(ccc(OC)c3C)[C@H]12 |
| InChI | InChI=1S/C20H24O4/c1-5-8-20-11(3)17(21)18(24-19(20)22)14-9-13-10(2)15(23-4)7-6-12(13)16(14)20/h5-7,11,14,16-18,21H,1,8-9H2,2-4H3/t11?,14-,16+,17?,18+,20+/m0/s1 |
| InChIKey | UGGMSADFCACRKN-HVGIKMIXSA-N |
| XLogP | 2.76 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|