C19H20O5 — CID 164672402
methyl (10S,11S)-6-methoxy-7,14-dimethyl-13-oxo-12-oxatetracyclo[9.2.2.02,10.03,8]pentadeca-3(8),4,6,14-tetraene-1-carboxylate (PubChem CID 164672402) has the molecular formula C19H20O5 and a molecular weight of 328.36 g/mol. Its IUPAC name is methyl (10S,11S)-6-methoxy-7,14-dimethyl-13-oxo-12-oxatetracyclo[9.2.2.02,10.03,8]pentadeca-3(8),4,6,14-tetraene-1-carboxylate.
| Compound Name | methyl (10S,11S)-6-methoxy-7,14-dimethyl-13-oxo-12-oxatetracyclo[9.2.2.02,10.03,8]pentadeca-3(8),4,6,14-tetraene-1-carboxylate |
|---|---|
| PubChem CID | 164672402 |
| Molecular Formula | C19H20O5 |
| Molecular Weight | 328.36 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | methyl (10S,11S)-6-methoxy-7,14-dimethyl-13-oxo-12-oxatetracyclo[9.2.2.02,10.03,8]pentadeca-3(8),4,6,14-tetraene-1-carboxylate |
| SMILES | COC(=O)C12C(=O)O[C@H](C=C1C)[C@H]1Cc3c(ccc(OC)c3C)C12 |
| InChI | InChI=1S/C19H20O5/c1-9-7-15-13-8-12-10(2)14(22-3)6-5-11(12)16(13)19(9,17(20)23-4)18(21)24-15/h5-7,13,15-16H,8H2,1-4H3/t13-,15-,16?,19?/m1/s1 |
| InChIKey | XDDCCOIAIZRNRA-IWIMUBHSSA-N |
| XLogP | 2.30 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.36 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|