C15H11F13N2 — CID 164682175
N-methyl-N-[(Z)-(2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoro-1-phenylheptylidene)amino]methanamine (PubChem CID 164682175) has the molecular formula C15H11F13N2 and a molecular weight of 466.24 g/mol. Its IUPAC name is N-methyl-N-[(Z)-(2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoro-1-phenylheptylidene)amino]methanamine.
| Compound Name | N-methyl-N-[(Z)-(2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoro-1-phenylheptylidene)amino]methanamine |
|---|---|
| PubChem CID | 164682175 |
| Molecular Formula | C15H11F13N2 |
| Molecular Weight | 466.24 g/mol |
| Exact Mass | 466.07 |
| IUPAC Name | N-methyl-N-[(Z)-(2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoro-1-phenylheptylidene)amino]methanamine |
| SMILES | CN(C)/N=C(/c1ccccc1)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C15H11F13N2/c1-30(2)29-9(8-6-4-3-5-7-8)10(16,17)11(18,19)12(20,21)13(22,23)14(24,25)15(26,27)28/h3-7H,1-2H3/b29-9- |
| InChIKey | HSFSHIDHELOKHY-JNNAGZRYSA-N |
| XLogP | 5.69 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.24 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|