C13H11F9N2 — CID 164682309
N-methyl-N-[(Z)-(2,2,3,3,4,4,5,5,5-nonafluoro-1-phenylpentylidene)amino]methanamine (PubChem CID 164682309) has the molecular formula C13H11F9N2 and a molecular weight of 366.23 g/mol. Its IUPAC name is N-methyl-N-[(Z)-(2,2,3,3,4,4,5,5,5-nonafluoro-1-phenylpentylidene)amino]methanamine.
| Compound Name | N-methyl-N-[(Z)-(2,2,3,3,4,4,5,5,5-nonafluoro-1-phenylpentylidene)amino]methanamine |
|---|---|
| PubChem CID | 164682309 |
| Molecular Formula | C13H11F9N2 |
| Molecular Weight | 366.23 g/mol |
| Exact Mass | 366.08 |
| IUPAC Name | N-methyl-N-[(Z)-(2,2,3,3,4,4,5,5,5-nonafluoro-1-phenylpentylidene)amino]methanamine |
| SMILES | CN(C)/N=C(/c1ccccc1)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C13H11F9N2/c1-24(2)23-9(8-6-4-3-5-7-8)10(14,15)11(16,17)12(18,19)13(20,21)22/h3-7H,1-2H3/b23-9- |
| InChIKey | XBQXLMZLCMNCJM-AQHIEDMUSA-N |
| XLogP | 4.42 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.23 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|