C12H23NO — CID 164682655
(E)-N,N-diethyl-4-methylhept-3-enamide (PubChem CID 164682655) has the molecular formula C12H23NO and a molecular weight of 197.32 g/mol. Its IUPAC name is (E)-N,N-diethyl-4-methylhept-3-enamide.
| Compound Name | (E)-N,N-diethyl-4-methylhept-3-enamide |
|---|---|
| PubChem CID | 164682655 |
| Molecular Formula | C12H23NO |
| Molecular Weight | 197.32 g/mol |
| Exact Mass | 197.18 |
| IUPAC Name | (E)-N,N-diethyl-4-methylhept-3-enamide |
| SMILES | CCC/C(C)=C/CC(=O)N(CC)CC |
| InChI | InChI=1S/C12H23NO/c1-5-8-11(4)9-10-12(14)13(6-2)7-3/h9H,5-8,10H2,1-4H3/b11-9+ |
| InChIKey | NZXJCJLCDSPWTB-PKNBQFBNSA-N |
| XLogP | 2.99 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.32 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|