C19H22OSi — CID 164685527
4-[dimethyl(phenyl)silyl]-2-phenylpenta-2,3-dien-1-ol (PubChem CID 164685527) has the molecular formula C19H22OSi and a molecular weight of 294.47 g/mol. Its IUPAC name is 4-[dimethyl(phenyl)silyl]-2-phenylpenta-2,3-dien-1-ol.
| Compound Name | 4-[dimethyl(phenyl)silyl]-2-phenylpenta-2,3-dien-1-ol |
|---|---|
| PubChem CID | 164685527 |
| Molecular Formula | C19H22OSi |
| Molecular Weight | 294.47 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | 4-[dimethyl(phenyl)silyl]-2-phenylpenta-2,3-dien-1-ol |
| SMILES | CC(=C=C(CO)c1ccccc1)[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C19H22OSi/c1-16(21(2,3)19-12-8-5-9-13-19)14-18(15-20)17-10-6-4-7-11-17/h4-13,20H,15H2,1-3H3 |
| InChIKey | GPZYUOHUMUARNM-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.47 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|