C14H20Si — CID 102425929
trimethyl(2-phenylpenta-2,3-dienyl)silane (PubChem CID 102425929) has the molecular formula C14H20Si and a molecular weight of 216.40 g/mol. Its IUPAC name is trimethyl(2-phenylpenta-2,3-dienyl)silane.
| Compound Name | trimethyl(2-phenylpenta-2,3-dienyl)silane |
|---|---|
| PubChem CID | 102425929 |
| Molecular Formula | C14H20Si |
| Molecular Weight | 216.40 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | trimethyl(2-phenylpenta-2,3-dienyl)silane |
| SMILES | CC=C=C(C[Si](C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C14H20Si/c1-5-9-14(12-15(2,3)4)13-10-7-6-8-11-13/h5-8,10-11H,12H2,1-4H3 |
| InChIKey | GDUVXAFJAFOFRK-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.40 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|