C14H19NOSi — CID 57374215
N-phenyl-2-trimethylsilylpenta-2,3-dienamide (PubChem CID 57374215) has the molecular formula C14H19NOSi and a molecular weight of 245.40 g/mol. Its IUPAC name is N-phenyl-2-trimethylsilylpenta-2,3-dienamide.
| Compound Name | N-phenyl-2-trimethylsilylpenta-2,3-dienamide |
|---|---|
| PubChem CID | 57374215 |
| Molecular Formula | C14H19NOSi |
| Molecular Weight | 245.40 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | N-phenyl-2-trimethylsilylpenta-2,3-dienamide |
| SMILES | CC=C=C(C(=O)Nc1ccccc1)[Si](C)(C)C |
| InChI | InChI=1S/C14H19NOSi/c1-5-9-13(17(2,3)4)14(16)15-12-10-7-6-8-11-12/h5-8,10-11H,1-4H3,(H,15,16) |
| InChIKey | LMVUABSZLGLUBX-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.40 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|