About N-phenyl-2-trimethylsilylpenta-2,3-dienamide
N-phenyl-2-trimethylsilylpenta-2,3-dienamide (PubChem CID 57374215) has the molecular formula C14H19NOSi
and a molecular weight of 245.40 g/mol. Its IUPAC name is N-phenyl-2-trimethylsilylpenta-2,3-dienamide.
Molecular Properties
| Compound Name | N-phenyl-2-trimethylsilylpenta-2,3-dienamide |
| PubChem CID | 57374215 |
| Molecular Formula | C14H19NOSi |
| Molecular Weight | 245.40 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | N-phenyl-2-trimethylsilylpenta-2,3-dienamide |
| SMILES | CC=C=C(C(=O)Nc1ccccc1)[Si](C)(C)C |
| InChI | InChI=1S/C14H19NOSi/c1-5-9-13(17(2,3)4)14(16)15-12-10-7-6-8-11-12/h5-8,10-11H,1-4H3,(H,15,16) |
| InChIKey | LMVUABSZLGLUBX-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.40 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N-phenyl-2-trimethylsilylpenta-2,3-dienamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-phenyl-2-trimethylsilylpenta-2,3-dienamide?
The IUPAC name of N-phenyl-2-trimethylsilylpenta-2,3-dienamide (CID 57374215) is N-phenyl-2-trimethylsilylpenta-2,3-dienamide.
What is the SMILES notation for N-phenyl-2-trimethylsilylpenta-2,3-dienamide?
The canonical SMILES for N-phenyl-2-trimethylsilylpenta-2,3-dienamide is CC=C=C(C(=O)Nc1ccccc1)[Si](C)(C)C.
What is the InChIKey of N-phenyl-2-trimethylsilylpenta-2,3-dienamide?
The InChIKey is LMVUABSZLGLUBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19NOSi/c1-5-9-13(17(2,3)4)14(16)15-12-10-7-6-8-11-12/h5-8,10-11H,1-4H3,(H,15,16).
What are the key properties of N-phenyl-2-trimethylsilylpenta-2,3-dienamide?
N-phenyl-2-trimethylsilylpenta-2,3-dienamide has a molecular weight of 245.40 g/mol, XLogP of 3.60, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-phenyl-2-trimethylsilylpenta-2,3-dienamide is sourced from PubChem (CID 57374215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).